C15H2F10O4 — CID 150314160
2,2-bis(2,3,4,5,6-pentafluorophenyl)propanedioic acid (PubChem CID 150314160) has the molecular formula C15H2F10O4 and a molecular weight of 436.16 g/mol. Its IUPAC name is 2,2-bis(2,3,4,5,6-pentafluorophenyl)propanedioic acid.
| Compound Name | 2,2-bis(2,3,4,5,6-pentafluorophenyl)propanedioic acid |
|---|---|
| PubChem CID | 150314160 |
| Molecular Formula | C15H2F10O4 |
| Molecular Weight | 436.16 g/mol |
| Exact Mass | 435.98 |
| IUPAC Name | 2,2-bis(2,3,4,5,6-pentafluorophenyl)propanedioic acid |
| SMILES | O=C(O)C(C(=O)O)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H2F10O4/c16-3-1(4(17)8(21)11(24)7(3)20)15(13(26)27,14(28)29)2-5(18)9(22)12(25)10(23)6(2)19/h(H,26,27)(H,28,29) |
| InChIKey | GMGCRDLOZSNXPR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.16 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|