C14H2F10O2 — CID 12571911
2,2-bis(2,3,4,5,6-pentafluorophenyl)acetic acid (PubChem CID 12571911) has the molecular formula C14H2F10O2 and a molecular weight of 392.15 g/mol. Its IUPAC name is 2,2-bis(2,3,4,5,6-pentafluorophenyl)acetic acid.
| Compound Name | 2,2-bis(2,3,4,5,6-pentafluorophenyl)acetic acid |
|---|---|
| PubChem CID | 12571911 |
| Molecular Formula | C14H2F10O2 |
| Molecular Weight | 392.15 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | 2,2-bis(2,3,4,5,6-pentafluorophenyl)acetic acid |
| SMILES | O=C(O)C(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H2F10O2/c15-4-2(5(16)9(20)12(23)8(4)19)1(14(25)26)3-6(17)10(21)13(24)11(22)7(3)18/h1H,(H,25,26) |
| InChIKey | MHBDIFZKHLWSDJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.15 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|