C8H3F5O3S — CID 175025424
2-hydroxy-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetic acid (PubChem CID 175025424) has the molecular formula C8H3F5O3S and a molecular weight of 274.17 g/mol. Its IUPAC name is 2-hydroxy-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetic acid.
| Compound Name | 2-hydroxy-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetic acid |
|---|---|
| PubChem CID | 175025424 |
| Molecular Formula | C8H3F5O3S |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 2-hydroxy-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetic acid |
| SMILES | O=C(O)C(O)Sc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8H3F5O3S/c9-1-2(10)4(12)6(5(13)3(1)11)17-8(16)7(14)15/h8,16H,(H,14,15) |
| InChIKey | IEDXPCCIOCFDJK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|