C14H2F10N2O2S — CID 87473950
S-[(2,3,4,5,6-pentafluorophenyl)carbamoyl] N-(2,3,4,5,6-pentafluorophenyl)carbamothioate (PubChem CID 87473950) has the molecular formula C14H2F10N2O2S and a molecular weight of 452.23 g/mol. Its IUPAC name is S-[(2,3,4,5,6-pentafluorophenyl)carbamoyl] N-(2,3,4,5,6-pentafluorophenyl)carbamothioate.
| Compound Name | S-[(2,3,4,5,6-pentafluorophenyl)carbamoyl] N-(2,3,4,5,6-pentafluorophenyl)carbamothioate |
|---|---|
| PubChem CID | 87473950 |
| Molecular Formula | C14H2F10N2O2S |
| Molecular Weight | 452.23 g/mol |
| Exact Mass | 451.97 |
| IUPAC Name | S-[(2,3,4,5,6-pentafluorophenyl)carbamoyl] N-(2,3,4,5,6-pentafluorophenyl)carbamothioate |
| SMILES | O=C(Nc1c(F)c(F)c(F)c(F)c1F)SC(=O)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H2F10N2O2S/c15-1-3(17)7(21)11(8(22)4(1)18)25-13(27)29-14(28)26-12-9(23)5(19)2(16)6(20)10(12)24/h(H,25,27)(H,26,28) |
| InChIKey | VOJATJODEPKXTH-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.23 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|