C10HClF11NO — CID 71672760
2-chloro-3,3,3-trifluoro-N-(2,3,4,5,6-pentafluorophenyl)-2-(trifluoromethyl)propanamide (PubChem CID 71672760) has the molecular formula C10HClF11NO and a molecular weight of 395.56 g/mol. Its IUPAC name is 2-chloro-3,3,3-trifluoro-N-(2,3,4,5,6-pentafluorophenyl)-2-(trifluoromethyl)propanamide.
| Compound Name | 2-chloro-3,3,3-trifluoro-N-(2,3,4,5,6-pentafluorophenyl)-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 71672760 |
| Molecular Formula | C10HClF11NO |
| Molecular Weight | 395.56 g/mol |
| Exact Mass | 394.96 |
| IUPAC Name | 2-chloro-3,3,3-trifluoro-N-(2,3,4,5,6-pentafluorophenyl)-2-(trifluoromethyl)propanamide |
| SMILES | O=C(Nc1c(F)c(F)c(F)c(F)c1F)C(Cl)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10HClF11NO/c11-8(9(17,18)19,10(20,21)22)7(24)23-6-4(15)2(13)1(12)3(14)5(6)16/h(H,23,24) |
| InChIKey | ORUITRNVFFXVHZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|