C11H8ClF6NO — CID 71672661
2-chloro-3,3,3-trifluoro-N-(2-methylphenyl)-2-(trifluoromethyl)propanamide (PubChem CID 71672661) has the molecular formula C11H8ClF6NO and a molecular weight of 319.63 g/mol. Its IUPAC name is 2-chloro-3,3,3-trifluoro-N-(2-methylphenyl)-2-(trifluoromethyl)propanamide.
| Compound Name | 2-chloro-3,3,3-trifluoro-N-(2-methylphenyl)-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 71672661 |
| Molecular Formula | C11H8ClF6NO |
| Molecular Weight | 319.63 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 2-chloro-3,3,3-trifluoro-N-(2-methylphenyl)-2-(trifluoromethyl)propanamide |
| SMILES | Cc1ccccc1NC(=O)C(Cl)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H8ClF6NO/c1-6-4-2-3-5-7(6)19-8(20)9(12,10(13,14)15)11(16,17)18/h2-5H,1H3,(H,19,20) |
| InChIKey | AEULKPVXHPCVTR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|