C10H10Br2FNO — CID 131850393
(2R)-2,3-dibromo-2-fluoro-N-(2-methylphenyl)propanamide (PubChem CID 131850393) has the molecular formula C10H10Br2FNO and a molecular weight of 339.00 g/mol. Its IUPAC name is (2R)-2,3-dibromo-2-fluoro-N-(2-methylphenyl)propanamide.
| Compound Name | (2R)-2,3-dibromo-2-fluoro-N-(2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 131850393 |
| Molecular Formula | C10H10Br2FNO |
| Molecular Weight | 339.00 g/mol |
| Exact Mass | 336.91 |
| IUPAC Name | (2R)-2,3-dibromo-2-fluoro-N-(2-methylphenyl)propanamide |
| SMILES | Cc1ccccc1NC(=O)[C@@](F)(Br)CBr |
| InChI | InChI=1S/C10H10Br2FNO/c1-7-4-2-3-5-8(7)14-9(15)10(12,13)6-11/h2-5H,6H2,1H3,(H,14,15)/t10-/m1/s1 |
| InChIKey | YLCWNOVXICJRLQ-SNVBAGLBSA-N |
| XLogP | 3.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.00 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|