C14H5ClF7NO — CID 86708437
4-chloro-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzamide (PubChem CID 86708437) has the molecular formula C14H5ClF7NO and a molecular weight of 371.64 g/mol. Its IUPAC name is 4-chloro-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-chloro-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 86708437 |
| Molecular Formula | C14H5ClF7NO |
| Molecular Weight | 371.64 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | 4-chloro-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H5ClF7NO/c15-6-3-1-5(2-4-6)13(24)23-12-10(18)8(16)7(14(20,21)22)9(17)11(12)19/h1-4H,(H,23,24) |
| InChIKey | VXQLMTCRMJXHHI-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.64 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|