C15H8F7N5O — CID 19264581
1-(pyrazol-1-ylmethyl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazole-3-carboxamide (PubChem CID 19264581) has the molecular formula C15H8F7N5O and a molecular weight of 407.25 g/mol. Its IUPAC name is 1-(pyrazol-1-ylmethyl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazole-3-carboxamide.
| Compound Name | 1-(pyrazol-1-ylmethyl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19264581 |
| Molecular Formula | C15H8F7N5O |
| Molecular Weight | 407.25 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 1-(pyrazol-1-ylmethyl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazole-3-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F)c1ccn(Cn2cccn2)n1 |
| InChI | InChI=1S/C15H8F7N5O/c16-9-8(15(20,21)22)10(17)12(19)13(11(9)18)24-14(28)7-2-5-27(25-7)6-26-4-1-3-23-26/h1-5H,6H2,(H,24,28) |
| InChIKey | ZLSJCHHKGMXKKO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|