C18H10F5N7O — CID 4867083
N-(2,3,4,5,6-pentafluorophenyl)-1-[(5-phenyltetrazol-2-yl)methyl]pyrazole-3-carboxamide (PubChem CID 4867083) has the molecular formula C18H10F5N7O and a molecular weight of 435.32 g/mol. Its IUPAC name is N-(2,3,4,5,6-pentafluorophenyl)-1-[(5-phenyltetrazol-2-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | N-(2,3,4,5,6-pentafluorophenyl)-1-[(5-phenyltetrazol-2-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 4867083 |
| Molecular Formula | C18H10F5N7O |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | N-(2,3,4,5,6-pentafluorophenyl)-1-[(5-phenyltetrazol-2-yl)methyl]pyrazole-3-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)c(F)c(F)c1F)c1ccn(Cn2nnc(-c3ccccc3)n2)n1 |
| InChI | InChI=1S/C18H10F5N7O/c19-11-12(20)14(22)16(15(23)13(11)21)24-18(31)10-6-7-29(26-10)8-30-27-17(25-28-30)9-4-2-1-3-5-9/h1-7H,8H2,(H,24,31) |
| InChIKey | JRSPQTSJDIXBGU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|