C18H22N8O — CID 19269078
N-(1-methylpiperidin-4-yl)-1-[(5-phenyltetrazol-2-yl)methyl]pyrazole-3-carboxamide (PubChem CID 19269078) has the molecular formula C18H22N8O and a molecular weight of 366.43 g/mol. Its IUPAC name is N-(1-methylpiperidin-4-yl)-1-[(5-phenyltetrazol-2-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | N-(1-methylpiperidin-4-yl)-1-[(5-phenyltetrazol-2-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19269078 |
| Molecular Formula | C18H22N8O |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-(1-methylpiperidin-4-yl)-1-[(5-phenyltetrazol-2-yl)methyl]pyrazole-3-carboxamide |
| SMILES | CN1CCC(NC(=O)c2ccn(Cn3nnc(-c4ccccc4)n3)n2)CC1 |
| InChI | InChI=1S/C18H22N8O/c1-24-10-7-15(8-11-24)19-18(27)16-9-12-25(21-16)13-26-22-17(20-23-26)14-5-3-2-4-6-14/h2-6,9,12,15H,7-8,10-11,13H2,1H3,(H,19,27) |
| InChIKey | JNRVIXHHBZNXDJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 93.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |