C22H25N7O — CID 19268926
N-(1-adamantyl)-1-[(5-phenyltetrazol-2-yl)methyl]pyrazole-3-carboxamide (PubChem CID 19268926) has the molecular formula C22H25N7O and a molecular weight of 403.49 g/mol. Its IUPAC name is N-(1-adamantyl)-1-[(5-phenyltetrazol-2-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | N-(1-adamantyl)-1-[(5-phenyltetrazol-2-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19268926 |
| Molecular Formula | C22H25N7O |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | N-(1-adamantyl)-1-[(5-phenyltetrazol-2-yl)methyl]pyrazole-3-carboxamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1ccn(Cn2nnc(-c3ccccc3)n2)n1 |
| InChI | InChI=1S/C22H25N7O/c30-21(23-22-11-15-8-16(12-22)10-17(9-15)13-22)19-6-7-28(25-19)14-29-26-20(24-27-29)18-4-2-1-3-5-18/h1-7,15-17H,8-14H2,(H,23,30) |
| InChIKey | BUGGNKUGDKJTLN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |