C18H9F8N3O2 — CID 19269326
1-[(4-fluorophenoxy)methyl]-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazole-3-carboxamide (PubChem CID 19269326) has the molecular formula C18H9F8N3O2 and a molecular weight of 451.27 g/mol. Its IUPAC name is 1-[(4-fluorophenoxy)methyl]-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazole-3-carboxamide.
| Compound Name | 1-[(4-fluorophenoxy)methyl]-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19269326 |
| Molecular Formula | C18H9F8N3O2 |
| Molecular Weight | 451.27 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | 1-[(4-fluorophenoxy)methyl]-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazole-3-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F)c1ccn(COc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H9F8N3O2/c19-8-1-3-9(4-2-8)31-7-29-6-5-10(28-29)17(30)27-16-14(22)12(20)11(18(24,25)26)13(21)15(16)23/h1-6H,7H2,(H,27,30) |
| InChIKey | ZAGYSJSAGOYHIT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.27 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|