C20H17F4N3O2 — CID 19275815
1-[(4-propan-2-ylphenoxy)methyl]-N-(2,3,5,6-tetrafluorophenyl)pyrazole-3-carboxamide (PubChem CID 19275815) has the molecular formula C20H17F4N3O2 and a molecular weight of 407.37 g/mol. Its IUPAC name is 1-[(4-propan-2-ylphenoxy)methyl]-N-(2,3,5,6-tetrafluorophenyl)pyrazole-3-carboxamide.
| Compound Name | 1-[(4-propan-2-ylphenoxy)methyl]-N-(2,3,5,6-tetrafluorophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19275815 |
| Molecular Formula | C20H17F4N3O2 |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 1-[(4-propan-2-ylphenoxy)methyl]-N-(2,3,5,6-tetrafluorophenyl)pyrazole-3-carboxamide |
| SMILES | CC(C)c1ccc(OCn2ccc(C(=O)Nc3c(F)c(F)cc(F)c3F)n2)cc1 |
| InChI | InChI=1S/C20H17F4N3O2/c1-11(2)12-3-5-13(6-4-12)29-10-27-8-7-16(26-27)20(28)25-19-17(23)14(21)9-15(22)18(19)24/h3-9,11H,10H2,1-2H3,(H,25,28) |
| InChIKey | QMSHKJDFKBTYIL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|