C15H15ClFN3O3 — CID 19269295
4-[[1-[(4-fluorophenoxy)methyl]pyrazole-3-carbonyl]amino]butanoyl chloride (PubChem CID 19269295) has the molecular formula C15H15ClFN3O3 and a molecular weight of 339.75 g/mol. Its IUPAC name is 4-[[1-[(4-fluorophenoxy)methyl]pyrazole-3-carbonyl]amino]butanoyl chloride.
| Compound Name | 4-[[1-[(4-fluorophenoxy)methyl]pyrazole-3-carbonyl]amino]butanoyl chloride |
|---|---|
| PubChem CID | 19269295 |
| Molecular Formula | C15H15ClFN3O3 |
| Molecular Weight | 339.75 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 4-[[1-[(4-fluorophenoxy)methyl]pyrazole-3-carbonyl]amino]butanoyl chloride |
| SMILES | O=C(Cl)CCCNC(=O)c1ccn(COc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H15ClFN3O3/c16-14(21)2-1-8-18-15(22)13-7-9-20(19-13)10-23-12-5-3-11(17)4-6-12/h3-7,9H,1-2,8,10H2,(H,18,22) |
| InChIKey | QMRYGGYAPUHLDJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.75 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|