C16H14FN3O3 — CID 19269316
1-[(4-fluorophenoxy)methyl]-N-(furan-2-ylmethyl)pyrazole-3-carboxamide (PubChem CID 19269316) has the molecular formula C16H14FN3O3 and a molecular weight of 315.30 g/mol. Its IUPAC name is 1-[(4-fluorophenoxy)methyl]-N-(furan-2-ylmethyl)pyrazole-3-carboxamide.
| Compound Name | 1-[(4-fluorophenoxy)methyl]-N-(furan-2-ylmethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19269316 |
| Molecular Formula | C16H14FN3O3 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 1-[(4-fluorophenoxy)methyl]-N-(furan-2-ylmethyl)pyrazole-3-carboxamide |
| SMILES | O=C(NCc1ccco1)c1ccn(COc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C16H14FN3O3/c17-12-3-5-13(6-4-12)23-11-20-8-7-15(19-20)16(21)18-10-14-2-1-9-22-14/h1-9H,10-11H2,(H,18,21) |
| InChIKey | PVYDLWNDQRSAFQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |