C16H10ClF7N2O — CID 162594959
(2S)-2-amino-3-(4-chlorophenyl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide (PubChem CID 162594959) has the molecular formula C16H10ClF7N2O and a molecular weight of 414.71 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-chlorophenyl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2S)-2-amino-3-(4-chlorophenyl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 162594959 |
| Molecular Formula | C16H10ClF7N2O |
| Molecular Weight | 414.71 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | (2S)-2-amino-3-(4-chlorophenyl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide |
| SMILES | N[C@@H](Cc1ccc(Cl)cc1)C(=O)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C16H10ClF7N2O/c17-7-3-1-6(2-4-7)5-8(25)15(27)26-14-12(20)10(18)9(16(22,23)24)11(19)13(14)21/h1-4,8H,5,25H2,(H,26,27)/t8-/m0/s1 |
| InChIKey | BUBCOEIQEBSOTD-QMMMGPOBSA-N |
| XLogP | 4.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.71 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|