C17H13F7N2O2 — CID 157370728
(2S)-2-amino-3-(4-methoxyphenyl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide (PubChem CID 157370728) has the molecular formula C17H13F7N2O2 and a molecular weight of 410.29 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-methoxyphenyl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2S)-2-amino-3-(4-methoxyphenyl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 157370728 |
| Molecular Formula | C17H13F7N2O2 |
| Molecular Weight | 410.29 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | (2S)-2-amino-3-(4-methoxyphenyl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide |
| SMILES | COc1ccc(C[C@H](N)C(=O)Nc2c(F)c(F)c(C(F)(F)F)c(F)c2F)cc1 |
| InChI | InChI=1S/C17H13F7N2O2/c1-28-8-4-2-7(3-5-8)6-9(25)16(27)26-15-13(20)11(18)10(17(22,23)24)12(19)14(15)21/h2-5,9H,6,25H2,1H3,(H,26,27)/t9-/m0/s1 |
| InChIKey | BJSPLEHTHRQDIL-VIFPVBQESA-N |
| XLogP | 3.78 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.29 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|