C16H19BN2O4 — CID 169082247
[4-[(2S)-2-amino-3-(4-methoxyanilino)-3-oxopropyl]phenyl]boronic acid (PubChem CID 169082247) has the molecular formula C16H19BN2O4 and a molecular weight of 314.15 g/mol. Its IUPAC name is [4-[(2S)-2-amino-3-(4-methoxyanilino)-3-oxopropyl]phenyl]boronic acid.
| Compound Name | [4-[(2S)-2-amino-3-(4-methoxyanilino)-3-oxopropyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 169082247 |
| Molecular Formula | C16H19BN2O4 |
| Molecular Weight | 314.15 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | [4-[(2S)-2-amino-3-(4-methoxyanilino)-3-oxopropyl]phenyl]boronic acid |
| SMILES | COc1ccc(NC(=O)[C@@H](N)Cc2ccc(B(O)O)cc2)cc1 |
| InChI | InChI=1S/C16H19BN2O4/c1-23-14-8-6-13(7-9-14)19-16(20)15(18)10-11-2-4-12(5-3-11)17(21)22/h2-9,15,21-22H,10,18H2,1H3,(H,19,20)/t15-/m0/s1 |
| InChIKey | OAUJNIUAAVXRCC-HNNXBMFYSA-N |
| XLogP | -0.12 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.15 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|