C19H20NO5- — CID 4248992
4-(4-methoxyanilino)-3-[(4-methoxyphenyl)methyl]-4-oxobutanoate (PubChem CID 4248992) has the molecular formula C19H20NO5- and a molecular weight of 342.37 g/mol. Its IUPAC name is 4-(4-methoxyanilino)-3-[(4-methoxyphenyl)methyl]-4-oxobutanoate.
| Compound Name | 4-(4-methoxyanilino)-3-[(4-methoxyphenyl)methyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 4248992 |
| Molecular Formula | C19H20NO5- |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 4-(4-methoxyanilino)-3-[(4-methoxyphenyl)methyl]-4-oxobutanoate |
| SMILES | COc1ccc(CC(CC(=O)[O-])C(=O)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C19H21NO5/c1-24-16-7-3-13(4-8-16)11-14(12-18(21)22)19(23)20-15-5-9-17(25-2)10-6-15/h3-10,14H,11-12H2,1-2H3,(H,20,23)(H,21,22)/p-1 |
| InChIKey | BXTXDEWRONTIFA-UHFFFAOYSA-M |
| XLogP | 1.64 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |