C18H17INO4- — CID 6963436
(2R)-4-(4-iodoanilino)-2-[(4-methoxyphenyl)methyl]-4-oxobutanoate (PubChem CID 6963436) has the molecular formula C18H17INO4- and a molecular weight of 438.24 g/mol. Its IUPAC name is (2R)-4-(4-iodoanilino)-2-[(4-methoxyphenyl)methyl]-4-oxobutanoate.
| Compound Name | (2R)-4-(4-iodoanilino)-2-[(4-methoxyphenyl)methyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 6963436 |
| Molecular Formula | C18H17INO4- |
| Molecular Weight | 438.24 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | (2R)-4-(4-iodoanilino)-2-[(4-methoxyphenyl)methyl]-4-oxobutanoate |
| SMILES | COc1ccc(C[C@H](CC(=O)Nc2ccc(I)cc2)C(=O)[O-])cc1 |
| InChI | InChI=1S/C18H18INO4/c1-24-16-8-2-12(3-9-16)10-13(18(22)23)11-17(21)20-15-6-4-14(19)5-7-15/h2-9,13H,10-11H2,1H3,(H,20,21)(H,22,23)/p-1/t13-/m1/s1 |
| InChIKey | LTYMYLLTRHNYDT-CYBMUJFWSA-M |
| XLogP | 2.24 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|