C13H18N2O4 — CID 4747247
2-(dimethylazaniumyl)-4-(4-methoxyanilino)-4-oxobutanoate (PubChem CID 4747247) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(dimethylazaniumyl)-4-(4-methoxyanilino)-4-oxobutanoate.
| Compound Name | 2-(dimethylazaniumyl)-4-(4-methoxyanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 4747247 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-(dimethylazaniumyl)-4-(4-methoxyanilino)-4-oxobutanoate |
| SMILES | COc1ccc(NC(=O)CC(C(=O)[O-])[NH+](C)C)cc1 |
| InChI | InChI=1S/C13H18N2O4/c1-15(2)11(13(17)18)8-12(16)14-9-4-6-10(19-3)7-5-9/h4-7,11H,8H2,1-3H3,(H,14,16)(H,17,18) |
| InChIKey | CTHQIAUULITEQE-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 82.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |