C19H19INO4- — CID 6991094
(2R,3S)-4-(4-iodoanilino)-2-[(4-methoxyphenyl)methyl]-3-methyl-4-oxobutanoate (PubChem CID 6991094) has the molecular formula C19H19INO4- and a molecular weight of 452.27 g/mol. Its IUPAC name is (2R,3S)-4-(4-iodoanilino)-2-[(4-methoxyphenyl)methyl]-3-methyl-4-oxobutanoate.
| Compound Name | (2R,3S)-4-(4-iodoanilino)-2-[(4-methoxyphenyl)methyl]-3-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 6991094 |
| Molecular Formula | C19H19INO4- |
| Molecular Weight | 452.27 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | (2R,3S)-4-(4-iodoanilino)-2-[(4-methoxyphenyl)methyl]-3-methyl-4-oxobutanoate |
| SMILES | COc1ccc(C[C@@H](C(=O)[O-])[C@H](C)C(=O)Nc2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C19H20INO4/c1-12(18(22)21-15-7-5-14(20)6-8-15)17(19(23)24)11-13-3-9-16(25-2)10-4-13/h3-10,12,17H,11H2,1-2H3,(H,21,22)(H,23,24)/p-1/t12-,17+/m0/s1 |
| InChIKey | MWBYZOBNHXRWCS-YVEFUNNKSA-M |
| XLogP | 2.48 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|