C18H18INO4 — CID 1075184
(2R)-4-(4-iodoanilino)-2-[(4-methoxyphenyl)methyl]-4-oxobutanoic acid (PubChem CID 1075184) has the molecular formula C18H18INO4 and a molecular weight of 439.25 g/mol. Its IUPAC name is (2R)-4-(4-iodoanilino)-2-[(4-methoxyphenyl)methyl]-4-oxobutanoic acid.
| Compound Name | (2R)-4-(4-iodoanilino)-2-[(4-methoxyphenyl)methyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 1075184 |
| Molecular Formula | C18H18INO4 |
| Molecular Weight | 439.25 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | (2R)-4-(4-iodoanilino)-2-[(4-methoxyphenyl)methyl]-4-oxobutanoic acid |
| SMILES | COc1ccc(C[C@H](CC(=O)Nc2ccc(I)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C18H18INO4/c1-24-16-8-2-12(3-9-16)10-13(18(22)23)11-17(21)20-15-6-4-14(19)5-7-15/h2-9,13H,10-11H2,1H3,(H,20,21)(H,22,23)/t13-/m1/s1 |
| InChIKey | LTYMYLLTRHNYDT-CYBMUJFWSA-N |
| XLogP | 3.57 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.25 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|