C25H26N2O5 — CID 4749709
2-[2-(4-methoxyphenyl)ethylamino]-4-oxo-4-(4-phenoxyanilino)butanoic acid (PubChem CID 4749709) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)ethylamino]-4-oxo-4-(4-phenoxyanilino)butanoic acid.
| Compound Name | 2-[2-(4-methoxyphenyl)ethylamino]-4-oxo-4-(4-phenoxyanilino)butanoic acid |
|---|---|
| PubChem CID | 4749709 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)ethylamino]-4-oxo-4-(4-phenoxyanilino)butanoic acid |
| SMILES | COc1ccc(CCNC(CC(=O)Nc2ccc(Oc3ccccc3)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C25H26N2O5/c1-31-20-11-7-18(8-12-20)15-16-26-23(25(29)30)17-24(28)27-19-9-13-22(14-10-19)32-21-5-3-2-4-6-21/h2-14,23,26H,15-17H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | BGMBNQXETBFUGX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |