C15H23N3O4 — CID 7591100
(2S)-4-(4-methoxyanilino)-2-[3-(methylamino)propylamino]-4-oxobutanoic acid (PubChem CID 7591100) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is (2S)-4-(4-methoxyanilino)-2-[3-(methylamino)propylamino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-(4-methoxyanilino)-2-[3-(methylamino)propylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 7591100 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (2S)-4-(4-methoxyanilino)-2-[3-(methylamino)propylamino]-4-oxobutanoic acid |
| SMILES | CNCCCN[C@@H](CC(=O)Nc1ccc(OC)cc1)C(=O)O |
| InChI | InChI=1S/C15H23N3O4/c1-16-8-3-9-17-13(15(20)21)10-14(19)18-11-4-6-12(22-2)7-5-11/h4-7,13,16-17H,3,8-10H2,1-2H3,(H,18,19)(H,20,21)/t13-/m0/s1 |
| InChIKey | GRRVNFCCUQDOPJ-ZDUSSCGKSA-N |
| XLogP | 0.68 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|