C19H21NO6S2 — CID 15120686
4-[[2-(acetylsulfanylmethyl)-3-(4-methoxyphenyl)propanoyl]amino]benzenesulfonic acid (PubChem CID 15120686) has the molecular formula C19H21NO6S2 and a molecular weight of 423.51 g/mol. Its IUPAC name is 4-[[2-(acetylsulfanylmethyl)-3-(4-methoxyphenyl)propanoyl]amino]benzenesulfonic acid.
| Compound Name | 4-[[2-(acetylsulfanylmethyl)-3-(4-methoxyphenyl)propanoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 15120686 |
| Molecular Formula | C19H21NO6S2 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 4-[[2-(acetylsulfanylmethyl)-3-(4-methoxyphenyl)propanoyl]amino]benzenesulfonic acid |
| SMILES | COc1ccc(CC(CSC(C)=O)C(=O)Nc2ccc(S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C19H21NO6S2/c1-13(21)27-12-15(11-14-3-7-17(26-2)8-4-14)19(22)20-16-5-9-18(10-6-16)28(23,24)25/h3-10,15H,11-12H2,1-2H3,(H,20,22)(H,23,24,25) |
| InChIKey | JKDQXWGFTQHBMI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|