C17H18NO5S2- — CID 91928788
4-[[2-[(4-methoxyphenyl)methyl]-3-sulfanylpropanoyl]amino]benzenesulfonate (PubChem CID 91928788) has the molecular formula C17H18NO5S2- and a molecular weight of 380.47 g/mol. Its IUPAC name is 4-[[2-[(4-methoxyphenyl)methyl]-3-sulfanylpropanoyl]amino]benzenesulfonate.
| Compound Name | 4-[[2-[(4-methoxyphenyl)methyl]-3-sulfanylpropanoyl]amino]benzenesulfonate |
|---|---|
| PubChem CID | 91928788 |
| Molecular Formula | C17H18NO5S2- |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 4-[[2-[(4-methoxyphenyl)methyl]-3-sulfanylpropanoyl]amino]benzenesulfonate |
| SMILES | COc1ccc(CC(CS)C(=O)Nc2ccc(S(=O)(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C17H19NO5S2/c1-23-15-6-2-12(3-7-15)10-13(11-24)17(19)18-14-4-8-16(9-5-14)25(20,21)22/h2-9,13,24H,10-11H2,1H3,(H,18,19)(H,20,21,22)/p-1 |
| InChIKey | ARRSWKMPTYGGTF-UHFFFAOYSA-M |
| XLogP | 2.33 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|