C13H18NNaO5S2 — CID 23701625
sodium 2-[[2-[(4-methoxyphenyl)methyl]-3-sulfanylpropanoyl]amino]ethanesulfonate (PubChem CID 23701625) has the molecular formula C13H18NNaO5S2 and a molecular weight of 355.41 g/mol. Its IUPAC name is sodium 2-[[2-[(4-methoxyphenyl)methyl]-3-sulfanylpropanoyl]amino]ethanesulfonate.
| Compound Name | sodium 2-[[2-[(4-methoxyphenyl)methyl]-3-sulfanylpropanoyl]amino]ethanesulfonate |
|---|---|
| PubChem CID | 23701625 |
| Molecular Formula | C13H18NNaO5S2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | sodium 2-[[2-[(4-methoxyphenyl)methyl]-3-sulfanylpropanoyl]amino]ethanesulfonate |
| SMILES | COc1ccc(CC(CS)C(=O)NCCS(=O)(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C13H19NO5S2.Na/c1-19-12-4-2-10(3-5-12)8-11(9-20)13(15)14-6-7-21(16,17)18;/h2-5,11,20H,6-9H2,1H3,(H,14,15)(H,16,17,18);/q;+1/p-1 |
| InChIKey | JSGLJFREGRBHJD-UHFFFAOYSA-M |
| XLogP | -2.55 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|