C13H19NO5S — CID 94027440
(2R)-N-(2-methoxyethyl)-2-(4-methoxyphenyl)sulfonylpropanamide (PubChem CID 94027440) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is (2R)-N-(2-methoxyethyl)-2-(4-methoxyphenyl)sulfonylpropanamide.
| Compound Name | (2R)-N-(2-methoxyethyl)-2-(4-methoxyphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 94027440 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | (2R)-N-(2-methoxyethyl)-2-(4-methoxyphenyl)sulfonylpropanamide |
| SMILES | COCCNC(=O)[C@@H](C)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H19NO5S/c1-10(13(15)14-8-9-18-2)20(16,17)12-6-4-11(19-3)5-7-12/h4-7,10H,8-9H2,1-3H3,(H,14,15)/t10-/m1/s1 |
| InChIKey | PIEFKDMQVJIUMC-SNVBAGLBSA-N |
| XLogP | 0.62 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|