C17H18BrNO5S — CID 22943507
2-(4-bromophenyl)sulfonyl-N-[(4-methoxyphenyl)methoxy]propanamide (PubChem CID 22943507) has the molecular formula C17H18BrNO5S and a molecular weight of 428.30 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfonyl-N-[(4-methoxyphenyl)methoxy]propanamide.
| Compound Name | 2-(4-bromophenyl)sulfonyl-N-[(4-methoxyphenyl)methoxy]propanamide |
|---|---|
| PubChem CID | 22943507 |
| Molecular Formula | C17H18BrNO5S |
| Molecular Weight | 428.30 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | 2-(4-bromophenyl)sulfonyl-N-[(4-methoxyphenyl)methoxy]propanamide |
| SMILES | COc1ccc(CONC(=O)C(C)S(=O)(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C17H18BrNO5S/c1-12(25(21,22)16-9-5-14(18)6-10-16)17(20)19-24-11-13-3-7-15(23-2)8-4-13/h3-10,12H,11H2,1-2H3,(H,19,20) |
| InChIKey | JAOFBQGPKGNYPD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|