C30H28BaN2O10S2 — CID 45049422
barium(2+);bis(4-[[2-(4-methoxyphenyl)acetyl]amino]benzenesulfonate) (PubChem CID 45049422) has the molecular formula C30H28BaN2O10S2 and a molecular weight of 778.02 g/mol. Its IUPAC name is barium(2+);bis(4-[[2-(4-methoxyphenyl)acetyl]amino]benzenesulfonate).
| Compound Name | barium(2+);bis(4-[[2-(4-methoxyphenyl)acetyl]amino]benzenesulfonate) |
|---|---|
| PubChem CID | 45049422 |
| Molecular Formula | C30H28BaN2O10S2 |
| Molecular Weight | 778.02 g/mol |
| Exact Mass | 778.02 |
| IUPAC Name | barium(2+);bis(4-[[2-(4-methoxyphenyl)acetyl]amino]benzenesulfonate) |
| SMILES | COc1ccc(CC(=O)Nc2ccc(S(=O)(=O)[O-])cc2)cc1.COc1ccc(CC(=O)Nc2ccc(S(=O)(=O)[O-])cc2)cc1.[Ba+2] |
| InChI | InChI=1S/2C15H15NO5S.Ba/c2*1-21-13-6-2-11(3-7-13)10-15(17)16-12-4-8-14(9-5-12)22(18,19)20;/h2*2-9H,10H2,1H3,(H,16,17)(H,18,19,20);/q;;+2/p-2 |
| InChIKey | RCOKQUMOODNKFT-UHFFFAOYSA-L |
| XLogP | 3.18 |
| TPSA | 191.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.02 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|