C19H21NO5S2 — CID 15120680
3-[[2-(acetylsulfanylmethyl)-3-(4-methylphenyl)propanoyl]amino]benzenesulfonic acid (PubChem CID 15120680) has the molecular formula C19H21NO5S2 and a molecular weight of 407.51 g/mol. Its IUPAC name is 3-[[2-(acetylsulfanylmethyl)-3-(4-methylphenyl)propanoyl]amino]benzenesulfonic acid.
| Compound Name | 3-[[2-(acetylsulfanylmethyl)-3-(4-methylphenyl)propanoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 15120680 |
| Molecular Formula | C19H21NO5S2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 3-[[2-(acetylsulfanylmethyl)-3-(4-methylphenyl)propanoyl]amino]benzenesulfonic acid |
| SMILES | CC(=O)SCC(Cc1ccc(C)cc1)C(=O)Nc1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C19H21NO5S2/c1-13-6-8-15(9-7-13)10-16(12-26-14(2)21)19(22)20-17-4-3-5-18(11-17)27(23,24)25/h3-9,11,16H,10,12H2,1-2H3,(H,20,22)(H,23,24,25) |
| InChIKey | KYUWXSZAPRNFKE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|