C25H29NO6S — CID 15670240
2,2-dimethylpropanoyloxymethyl 3-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]benzoate (PubChem CID 15670240) has the molecular formula C25H29NO6S and a molecular weight of 471.58 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl 3-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]benzoate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl 3-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 15670240 |
| Molecular Formula | C25H29NO6S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl 3-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]benzoate |
| SMILES | CC(=O)SCC(Cc1ccccc1)C(=O)Nc1cccc(C(=O)OCOC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C25H29NO6S/c1-17(27)33-15-20(13-18-9-6-5-7-10-18)22(28)26-21-12-8-11-19(14-21)23(29)31-16-32-24(30)25(2,3)4/h5-12,14,20H,13,15-16H2,1-4H3,(H,26,28) |
| InChIKey | ZXNIVNGSCMCWSG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|