C23H28N2O4S — CID 57174560
S-(3-anilino-2-benzyl-3-oxopropyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethanethioate (PubChem CID 57174560) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is S-(3-anilino-2-benzyl-3-oxopropyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethanethioate.
| Compound Name | S-(3-anilino-2-benzyl-3-oxopropyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethanethioate |
|---|---|
| PubChem CID | 57174560 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | S-(3-anilino-2-benzyl-3-oxopropyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethanethioate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)SCC(Cc1ccccc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C23H28N2O4S/c1-23(2,3)29-22(28)24-15-20(26)30-16-18(14-17-10-6-4-7-11-17)21(27)25-19-12-8-5-9-13-19/h4-13,18H,14-16H2,1-3H3,(H,24,28)(H,25,27) |
| InChIKey | UFFUUMMXEPOFHW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|