C29H33N3O5 — CID 58001205
tert-butyl N-[2-[[4-[4-hydroxy-2-(phenylcarbamoyl)butyl]benzoyl]amino]phenyl]carbamate (PubChem CID 58001205) has the molecular formula C29H33N3O5 and a molecular weight of 503.60 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-[4-hydroxy-2-(phenylcarbamoyl)butyl]benzoyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-[4-hydroxy-2-(phenylcarbamoyl)butyl]benzoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 58001205 |
| Molecular Formula | C29H33N3O5 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | tert-butyl N-[2-[[4-[4-hydroxy-2-(phenylcarbamoyl)butyl]benzoyl]amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1NC(=O)c1ccc(CC(CCO)C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C29H33N3O5/c1-29(2,3)37-28(36)32-25-12-8-7-11-24(25)31-26(34)21-15-13-20(14-16-21)19-22(17-18-33)27(35)30-23-9-5-4-6-10-23/h4-16,22,33H,17-19H2,1-3H3,(H,30,35)(H,31,34)(H,32,36) |
| InChIKey | JUZYYCHDPBACRC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |