C21H26N2O4 — CID 20786184
tert-butyl N-[2-[[4-(1-hydroxypropyl)benzoyl]amino]phenyl]carbamate (PubChem CID 20786184) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-(1-hydroxypropyl)benzoyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-(1-hydroxypropyl)benzoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 20786184 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | tert-butyl N-[2-[[4-(1-hydroxypropyl)benzoyl]amino]phenyl]carbamate |
| SMILES | CCC(O)c1ccc(C(=O)Nc2ccccc2NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H26N2O4/c1-5-18(24)14-10-12-15(13-11-14)19(25)22-16-8-6-7-9-17(16)23-20(26)27-21(2,3)4/h6-13,18,24H,5H2,1-4H3,(H,22,25)(H,23,26) |
| InChIKey | URONBHXQGRKVAO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |