C18H21N2O4Y- — CID 58001092
tert-butyl N-[2-(benzoylamino)phenyl]carbamate;yttrium;hydrate (PubChem CID 58001092) has the molecular formula C18H21N2O4Y- and a molecular weight of 418.28 g/mol. Its IUPAC name is tert-butyl N-[2-(benzoylamino)phenyl]carbamate;yttrium;hydrate.
| Compound Name | tert-butyl N-[2-(benzoylamino)phenyl]carbamate;yttrium;hydrate |
|---|---|
| PubChem CID | 58001092 |
| Molecular Formula | C18H21N2O4Y- |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | tert-butyl N-[2-(benzoylamino)phenyl]carbamate;yttrium;hydrate |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1NC(=O)c1cc[c-]cc1.O.[Y] |
| InChI | InChI=1S/C18H19N2O3.H2O.Y/c1-18(2,3)23-17(22)20-15-12-8-7-11-14(15)19-16(21)13-9-5-4-6-10-13;;/h5-12H,1-3H3,(H,19,21)(H,20,22);1H2;/q-1;; |
| InChIKey | CXHSLSODGBQJOS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|