C21H24N2O3 — CID 89027172
tert-butyl N-[2-[(3-ethenyl-5-methylbenzoyl)amino]phenyl]carbamate (PubChem CID 89027172) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-ethenyl-5-methylbenzoyl)amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3-ethenyl-5-methylbenzoyl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 89027172 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | tert-butyl N-[2-[(3-ethenyl-5-methylbenzoyl)amino]phenyl]carbamate |
| SMILES | C=Cc1cc(C)cc(C(=O)Nc2ccccc2NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C21H24N2O3/c1-6-15-11-14(2)12-16(13-15)19(24)22-17-9-7-8-10-18(17)23-20(25)26-21(3,4)5/h6-13H,1H2,2-5H3,(H,22,24)(H,23,25) |
| InChIKey | TWOKLOAKWBJTJS-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |