C26H28N4O5 — CID 22668094
tert-butyl N-[2-[[4-[(2-methoxy-2-pyridin-3-ylacetyl)amino]benzoyl]amino]phenyl]carbamate (PubChem CID 22668094) has the molecular formula C26H28N4O5 and a molecular weight of 476.53 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-[(2-methoxy-2-pyridin-3-ylacetyl)amino]benzoyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-[(2-methoxy-2-pyridin-3-ylacetyl)amino]benzoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 22668094 |
| Molecular Formula | C26H28N4O5 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | tert-butyl N-[2-[[4-[(2-methoxy-2-pyridin-3-ylacetyl)amino]benzoyl]amino]phenyl]carbamate |
| SMILES | COC(C(=O)Nc1ccc(C(=O)Nc2ccccc2NC(=O)OC(C)(C)C)cc1)c1cccnc1 |
| InChI | InChI=1S/C26H28N4O5/c1-26(2,3)35-25(33)30-21-10-6-5-9-20(21)29-23(31)17-11-13-19(14-12-17)28-24(32)22(34-4)18-8-7-15-27-16-18/h5-16,22H,1-4H3,(H,28,32)(H,29,31)(H,30,33) |
| InChIKey | LZVIGRAEJQTFNH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |