C10H12N2O6S2 — CID 86679031
(2R)-2-amino-3-[(3-sulfophenyl)carbamoylsulfanyl]propanoic acid (PubChem CID 86679031) has the molecular formula C10H12N2O6S2 and a molecular weight of 320.35 g/mol. Its IUPAC name is (2R)-2-amino-3-[(3-sulfophenyl)carbamoylsulfanyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[(3-sulfophenyl)carbamoylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 86679031 |
| Molecular Formula | C10H12N2O6S2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | (2R)-2-amino-3-[(3-sulfophenyl)carbamoylsulfanyl]propanoic acid |
| SMILES | N[C@@H](CSC(=O)Nc1cccc(S(=O)(=O)O)c1)C(=O)O |
| InChI | InChI=1S/C10H12N2O6S2/c11-8(9(13)14)5-19-10(15)12-6-2-1-3-7(4-6)20(16,17)18/h1-4,8H,5,11H2,(H,12,15)(H,13,14)(H,16,17,18)/t8-/m0/s1 |
| InChIKey | JRIBRMZQTXFDHT-QMMMGPOBSA-N |
| XLogP | 0.61 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|