C10H13NO7S — CID 87122496
2-aminobutanedioic acid;benzenesulfonic acid (PubChem CID 87122496) has the molecular formula C10H13NO7S and a molecular weight of 291.28 g/mol. Its IUPAC name is 2-aminobutanedioic acid;benzenesulfonic acid.
| Compound Name | 2-aminobutanedioic acid;benzenesulfonic acid |
|---|---|
| PubChem CID | 87122496 |
| Molecular Formula | C10H13NO7S |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 2-aminobutanedioic acid;benzenesulfonic acid |
| SMILES | NC(CC(=O)O)C(=O)O.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C6H6O3S.C4H7NO4/c7-10(8,9)6-4-2-1-3-5-6;5-2(4(8)9)1-3(6)7/h1-5H,(H,7,8,9);2H,1,5H2,(H,6,7)(H,8,9) |
| InChIKey | FZXIGEWNUBLAFD-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 154.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|