C14H19NO5S2 — CID 15120658
2-[[(2S)-2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]ethanesulfonic acid (PubChem CID 15120658) has the molecular formula C14H19NO5S2 and a molecular weight of 345.44 g/mol. Its IUPAC name is 2-[[(2S)-2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[(2S)-2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 15120658 |
| Molecular Formula | C14H19NO5S2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 2-[[(2S)-2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]ethanesulfonic acid |
| SMILES | CC(=O)SC[C@@H](Cc1ccccc1)C(=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C14H19NO5S2/c1-11(16)21-10-13(9-12-5-3-2-4-6-12)14(17)15-7-8-22(18,19)20/h2-6,13H,7-10H2,1H3,(H,15,17)(H,18,19,20)/t13-/m1/s1 |
| InChIKey | FGLKGCBBBIQSEO-CYBMUJFWSA-N |
| XLogP | 1.13 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|