C21H27N3O5S — CID 142913661
2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-phenylbutanoyl]amino]ethanesulfonic acid (PubChem CID 142913661) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is 2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-phenylbutanoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-phenylbutanoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 142913661 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-phenylbutanoyl]amino]ethanesulfonic acid |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCc1ccccc1)C(=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C21H27N3O5S/c22-18(15-17-9-5-2-6-10-17)20(25)24-19(12-11-16-7-3-1-4-8-16)21(26)23-13-14-30(27,28)29/h1-10,18-19H,11-15,22H2,(H,23,26)(H,24,25)(H,27,28,29)/t18-,19-/m0/s1 |
| InChIKey | ZYVXJIAAMONDFD-OALUTQOASA-N |
| XLogP | 0.68 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|