C41H44F2N4O5 — CID 87514320
(2S)-2-amino-N-[(3S,9S)-9-[[(2S)-2-amino-3-phenylpropanoyl]amino]-5,7-difluoro-4,6,8-trioxo-1,11-diphenylundecan-3-yl]-3-phenylpropanamide (PubChem CID 87514320) has the molecular formula C41H44F2N4O5 and a molecular weight of 710.82 g/mol. Its IUPAC name is (2S)-2-amino-N-[(3S,9S)-9-[[(2S)-2-amino-3-phenylpropanoyl]amino]-5,7-difluoro-4,6,8-trioxo-1,11-diphenylundecan-3-yl]-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-[(3S,9S)-9-[[(2S)-2-amino-3-phenylpropanoyl]amino]-5,7-difluoro-4,6,8-trioxo-1,11-diphenylundecan-3-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 87514320 |
| Molecular Formula | C41H44F2N4O5 |
| Molecular Weight | 710.82 g/mol |
| Exact Mass | 710.33 |
| IUPAC Name | (2S)-2-amino-N-[(3S,9S)-9-[[(2S)-2-amino-3-phenylpropanoyl]amino]-5,7-difluoro-4,6,8-trioxo-1,11-diphenylundecan-3-yl]-3-phenylpropanamide |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCc1ccccc1)C(=O)C(F)C(=O)C(F)C(=O)[C@H](CCc1ccccc1)NC(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C41H44F2N4O5/c42-35(37(48)33(23-21-27-13-5-1-6-14-27)46-40(51)31(44)25-29-17-9-3-10-18-29)39(50)36(43)38(49)34(24-22-28-15-7-2-8-16-28)47-41(52)32(45)26-30-19-11-4-12-20-30/h1-20,31-36H,21-26,44-45H2,(H,46,51)(H,47,52)/t31-,32-,33-,34-,35?,36?/m0/s1 |
| InChIKey | RSXFCBRIRBKZGN-AEEHPLFFSA-N |
| XLogP | 3.75 |
| TPSA | 161.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.82 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|