C12H16NO4S2- — CID 91928799
2-[[(2R)-2-benzyl-3-sulfanylpropanoyl]amino]ethanesulfonate (PubChem CID 91928799) has the molecular formula C12H16NO4S2- and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-[[(2R)-2-benzyl-3-sulfanylpropanoyl]amino]ethanesulfonate.
| Compound Name | 2-[[(2R)-2-benzyl-3-sulfanylpropanoyl]amino]ethanesulfonate |
|---|---|
| PubChem CID | 91928799 |
| Molecular Formula | C12H16NO4S2- |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-[[(2R)-2-benzyl-3-sulfanylpropanoyl]amino]ethanesulfonate |
| SMILES | O=C(NCCS(=O)(=O)[O-])[C@H](CS)Cc1ccccc1 |
| InChI | InChI=1S/C12H17NO4S2/c14-12(13-6-7-19(15,16)17)11(9-18)8-10-4-2-1-3-5-10/h1-5,11,18H,6-9H2,(H,13,14)(H,15,16,17)/p-1/t11-/m0/s1 |
| InChIKey | BBZZLTVAUKZPJI-NSHDSACASA-M |
| XLogP | 0.44 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|