C15H23NO4S2 — CID 56625140
(2R)-2-benzyl-N-[(2S)-1-hydroxy-4-methylsulfonylbutan-2-yl]-3-sulfanylpropanamide (PubChem CID 56625140) has the molecular formula C15H23NO4S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is (2R)-2-benzyl-N-[(2S)-1-hydroxy-4-methylsulfonylbutan-2-yl]-3-sulfanylpropanamide.
| Compound Name | (2R)-2-benzyl-N-[(2S)-1-hydroxy-4-methylsulfonylbutan-2-yl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 56625140 |
| Molecular Formula | C15H23NO4S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | (2R)-2-benzyl-N-[(2S)-1-hydroxy-4-methylsulfonylbutan-2-yl]-3-sulfanylpropanamide |
| SMILES | CS(=O)(=O)CC[C@@H](CO)NC(=O)[C@H](CS)Cc1ccccc1 |
| InChI | InChI=1S/C15H23NO4S2/c1-22(19,20)8-7-14(10-17)16-15(18)13(11-21)9-12-5-3-2-4-6-12/h2-6,13-14,17,21H,7-11H2,1H3,(H,16,18)/t13-,14-/m0/s1 |
| InChIKey | ZHYPMDANZYQPBV-KBPBESRZSA-N |
| XLogP | 0.69 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|