C15H23NO3S2 — CID 56624211
(2S)-2-benzyl-N-[(2S)-1-hydroxy-4-methylsulfinylbutan-2-yl]-3-sulfanylpropanamide (PubChem CID 56624211) has the molecular formula C15H23NO3S2 and a molecular weight of 329.49 g/mol. Its IUPAC name is (2S)-2-benzyl-N-[(2S)-1-hydroxy-4-methylsulfinylbutan-2-yl]-3-sulfanylpropanamide.
| Compound Name | (2S)-2-benzyl-N-[(2S)-1-hydroxy-4-methylsulfinylbutan-2-yl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 56624211 |
| Molecular Formula | C15H23NO3S2 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | (2S)-2-benzyl-N-[(2S)-1-hydroxy-4-methylsulfinylbutan-2-yl]-3-sulfanylpropanamide |
| SMILES | CS(=O)CC[C@@H](CO)NC(=O)[C@@H](CS)Cc1ccccc1 |
| InChI | InChI=1S/C15H23NO3S2/c1-21(19)8-7-14(10-17)16-15(18)13(11-20)9-12-5-3-2-4-6-12/h2-6,13-14,17,20H,7-11H2,1H3,(H,16,18)/t13-,14+,21?/m1/s1 |
| InChIKey | FXEGLEJKPANBPJ-LOPBJPMSSA-N |
| XLogP | 1.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|