C22H27NO3S2 — CID 12962730
S-[(2S)-2-benzyl-3-[[(2S)-1-hydroxy-4-methylsulfanylbutan-2-yl]amino]-3-oxopropyl] benzenecarbothioate (PubChem CID 12962730) has the molecular formula C22H27NO3S2 and a molecular weight of 417.60 g/mol. Its IUPAC name is S-[(2S)-2-benzyl-3-[[(2S)-1-hydroxy-4-methylsulfanylbutan-2-yl]amino]-3-oxopropyl] benzenecarbothioate.
| Compound Name | S-[(2S)-2-benzyl-3-[[(2S)-1-hydroxy-4-methylsulfanylbutan-2-yl]amino]-3-oxopropyl] benzenecarbothioate |
|---|---|
| PubChem CID | 12962730 |
| Molecular Formula | C22H27NO3S2 |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | S-[(2S)-2-benzyl-3-[[(2S)-1-hydroxy-4-methylsulfanylbutan-2-yl]amino]-3-oxopropyl] benzenecarbothioate |
| SMILES | CSCC[C@@H](CO)NC(=O)[C@@H](CSC(=O)c1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C22H27NO3S2/c1-27-13-12-20(15-24)23-21(25)19(14-17-8-4-2-5-9-17)16-28-22(26)18-10-6-3-7-11-18/h2-11,19-20,24H,12-16H2,1H3,(H,23,25)/t19-,20+/m1/s1 |
| InChIKey | QPSZCNYRLXJRAR-UXHICEINSA-N |
| XLogP | 3.65 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|