C23H26F3NO3S2 — CID 20540900
S-[3-[(1-hydroxy-4-methylsulfanylbutyl)amino]-3-oxo-2-[[4-(trifluoromethyl)phenyl]methyl]propyl] benzenecarbothioate (PubChem CID 20540900) has the molecular formula C23H26F3NO3S2 and a molecular weight of 485.59 g/mol. Its IUPAC name is S-[3-[(1-hydroxy-4-methylsulfanylbutyl)amino]-3-oxo-2-[[4-(trifluoromethyl)phenyl]methyl]propyl] benzenecarbothioate.
| Compound Name | S-[3-[(1-hydroxy-4-methylsulfanylbutyl)amino]-3-oxo-2-[[4-(trifluoromethyl)phenyl]methyl]propyl] benzenecarbothioate |
|---|---|
| PubChem CID | 20540900 |
| Molecular Formula | C23H26F3NO3S2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | S-[3-[(1-hydroxy-4-methylsulfanylbutyl)amino]-3-oxo-2-[[4-(trifluoromethyl)phenyl]methyl]propyl] benzenecarbothioate |
| SMILES | CSCCCC(O)NC(=O)C(CSC(=O)c1ccccc1)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H26F3NO3S2/c1-31-13-5-8-20(28)27-21(29)18(15-32-22(30)17-6-3-2-4-7-17)14-16-9-11-19(12-10-16)23(24,25)26/h2-4,6-7,9-12,18,20,28H,5,8,13-15H2,1H3,(H,27,29) |
| InChIKey | XPFXWMTVPXZYKQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|